C20H23NO3 — CID 132580669
9H-fluoren-9-yl N-[(2S)-2-hydroxy-3,3-dimethylbutyl]carbamate (PubChem CID 132580669) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[(2S)-2-hydroxy-3,3-dimethylbutyl]carbamate.
| Compound Name | 9H-fluoren-9-yl N-[(2S)-2-hydroxy-3,3-dimethylbutyl]carbamate |
|---|---|
| PubChem CID | 132580669 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 9H-fluoren-9-yl N-[(2S)-2-hydroxy-3,3-dimethylbutyl]carbamate |
| SMILES | CC(C)(C)[C@H](O)CNC(=O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H23NO3/c1-20(2,3)17(22)12-21-19(23)24-18-15-10-6-4-8-13(15)14-9-5-7-11-16(14)18/h4-11,17-18,22H,12H2,1-3H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | MYJJJKXJIQCJLT-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |