C28H36N2O5 — CID 90334145
9H-fluoren-9-yl N-[3-[3-[(5-methyl-4-oxoheptanoyl)amino]propoxy]propyl]carbamate (PubChem CID 90334145) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[3-[3-[(5-methyl-4-oxoheptanoyl)amino]propoxy]propyl]carbamate.
| Compound Name | 9H-fluoren-9-yl N-[3-[3-[(5-methyl-4-oxoheptanoyl)amino]propoxy]propyl]carbamate |
|---|---|
| PubChem CID | 90334145 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 9H-fluoren-9-yl N-[3-[3-[(5-methyl-4-oxoheptanoyl)amino]propoxy]propyl]carbamate |
| SMILES | CCC(C)C(=O)CCC(=O)NCCCOCCCNC(=O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H36N2O5/c1-3-20(2)25(31)14-15-26(32)29-16-8-18-34-19-9-17-30-28(33)35-27-23-12-6-4-10-21(23)22-11-5-7-13-24(22)27/h4-7,10-13,20,27H,3,8-9,14-19H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | ILLPWEFOZRTZFR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|