C25H30N2O7 — CID 174211270
9H-fluoren-9-yl 3-[2-[2-[3-(methoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate (PubChem CID 174211270) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is 9H-fluoren-9-yl 3-[2-[2-[3-(methoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate.
| Compound Name | 9H-fluoren-9-yl 3-[2-[2-[3-(methoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 174211270 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 9H-fluoren-9-yl 3-[2-[2-[3-(methoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate |
| SMILES | COC(=O)NCCC(=O)NCCOCCOCCC(=O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H30N2O7/c1-31-25(30)27-12-10-22(28)26-13-15-33-17-16-32-14-11-23(29)34-24-20-8-4-2-6-18(20)19-7-3-5-9-21(19)24/h2-9,24H,10-17H2,1H3,(H,26,28)(H,27,30) |
| InChIKey | YHVUFRIROBIRRB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|