C24H25NO4 — CID 159037890
ethane;2-(9H-fluoren-9-yloxycarbonylamino)benzoic acid;methane (PubChem CID 159037890) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethane;2-(9H-fluoren-9-yloxycarbonylamino)benzoic acid;methane.
| Compound Name | ethane;2-(9H-fluoren-9-yloxycarbonylamino)benzoic acid;methane |
|---|---|
| PubChem CID | 159037890 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethane;2-(9H-fluoren-9-yloxycarbonylamino)benzoic acid;methane |
| SMILES | C.CC.O=C(Nc1ccccc1C(=O)O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H15NO4.C2H6.CH4/c23-20(24)17-11-5-6-12-18(17)22-21(25)26-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)19;1-2;/h1-12,19H,(H,22,25)(H,23,24);1-2H3;1H4 |
| InChIKey | JVRJFKWWXLZQKN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |