C25H27N2O4+ — CID 168783129
(2S)-2-[(3R)-3-ethynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (PubChem CID 168783129) has the molecular formula C25H27N2O4+ and a molecular weight of 419.50 g/mol. Its IUPAC name is (2S)-2-[(3R)-3-ethynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid.
| Compound Name | (2S)-2-[(3R)-3-ethynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 168783129 |
| Molecular Formula | C25H27N2O4+ |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (2S)-2-[(3R)-3-ethynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| SMILES | C#C[C@]1([C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)CC[N+](C)(C)C1 |
| InChI | InChI=1S/C25H26N2O4/c1-4-25(13-14-27(2,3)16-25)22(23(28)29)26-24(30)31-15-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h1,5-12,21-22H,13-16H2,2-3H3,(H-,26,28,29,30)/p+1/t22-,25+/m1/s1 |
| InChIKey | QYQLCXICGIRMHP-RDGATRHJSA-O |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|