C25H29N2O4+ — CID 168782950
(2R)-2-(1,1-dimethyl-3-prop-2-enylazetidin-1-ium-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (PubChem CID 168782950) has the molecular formula C25H29N2O4+ and a molecular weight of 421.52 g/mol. Its IUPAC name is (2R)-2-(1,1-dimethyl-3-prop-2-enylazetidin-1-ium-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid.
| Compound Name | (2R)-2-(1,1-dimethyl-3-prop-2-enylazetidin-1-ium-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 168782950 |
| Molecular Formula | C25H29N2O4+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (2R)-2-(1,1-dimethyl-3-prop-2-enylazetidin-1-ium-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| SMILES | C=CCC1([C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)C[N+](C)(C)C1 |
| InChI | InChI=1S/C25H28N2O4/c1-4-13-25(15-27(2,3)16-25)22(23(28)29)26-24(30)31-14-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h4-12,21-22H,1,13-16H2,2-3H3,(H-,26,28,29,30)/p+1/t22-/m0/s1 |
| InChIKey | LUQCMEUCLDUILX-QFIPXVFZSA-O |
| XLogP | 3.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|