C25H30N5O4+ — CID 168783097
(2R)-2-[(3S)-3-(2-azidoethyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (PubChem CID 168783097) has the molecular formula C25H30N5O4+ and a molecular weight of 464.55 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-(2-azidoethyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid.
| Compound Name | (2R)-2-[(3S)-3-(2-azidoethyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 168783097 |
| Molecular Formula | C25H30N5O4+ |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2R)-2-[(3S)-3-(2-azidoethyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| SMILES | C[N+]1(C)CC[C@@](CCN=[N+]=[N-])([C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)C1 |
| InChI | InChI=1S/C25H29N5O4/c1-30(2)14-12-25(16-30,11-13-27-29-26)22(23(31)32)28-24(33)34-15-21-19-9-5-3-7-17(19)18-8-4-6-10-20(18)21/h3-10,21-22H,11-16H2,1-2H3,(H-,28,31,32,33)/p+1/t22-,25+/m0/s1 |
| InChIKey | XCWMIKCJIWASJG-WIOPSUGQSA-O |
| XLogP | 4.15 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|