C28H40N6O4+2 — CID 168782923
[4-azido-2-[(S)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]butyl]-trimethylazanium (PubChem CID 168782923) has the molecular formula C28H40N6O4+2 and a molecular weight of 524.67 g/mol. Its IUPAC name is [4-azido-2-[(S)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]butyl]-trimethylazanium.
| Compound Name | [4-azido-2-[(S)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]butyl]-trimethylazanium |
|---|---|
| PubChem CID | 168782923 |
| Molecular Formula | C28H40N6O4+2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | [4-azido-2-[(S)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]butyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CCN=[N+]=[N-])(C[N+](C)(C)C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C28H38N6O4/c1-33(2,3)18-28(15-16-30-32-29,19-34(4,5)6)25(26(35)36)31-27(37)38-17-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,24-25H,15-19H2,1-6H3/p+2/t25-/m1/s1 |
| InChIKey | CHVHNSVUUDELBZ-RUZDIDTESA-P |
| XLogP | 4.08 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|