C29H39N3O4+2 — CID 168783112
[2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]pent-3-ynyl]-trimethylazanium (PubChem CID 168783112) has the molecular formula C29H39N3O4+2 and a molecular weight of 493.65 g/mol. Its IUPAC name is [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]pent-3-ynyl]-trimethylazanium.
| Compound Name | [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]pent-3-ynyl]-trimethylazanium |
|---|---|
| PubChem CID | 168783112 |
| Molecular Formula | C29H39N3O4+2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]pent-3-ynyl]-trimethylazanium |
| SMILES | CC#CC(C[N+](C)(C)C)(C[N+](C)(C)C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C29H37N3O4/c1-8-17-29(19-31(2,3)4,20-32(5,6)7)26(27(33)34)30-28(35)36-18-25-23-15-11-9-13-21(23)22-14-10-12-16-24(22)25/h9-16,25-26H,18-20H2,1-7H3/p+2/t26-/m0/s1 |
| InChIKey | MYWKRQGFAILNNN-SANMLTNESA-P |
| XLogP | 3.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|