C30H41N3O4+2 — CID 168782997
[2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]hex-4-ynyl]-trimethylazanium (PubChem CID 168782997) has the molecular formula C30H41N3O4+2 and a molecular weight of 507.68 g/mol. Its IUPAC name is [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]hex-4-ynyl]-trimethylazanium.
| Compound Name | [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]hex-4-ynyl]-trimethylazanium |
|---|---|
| PubChem CID | 168782997 |
| Molecular Formula | C30H41N3O4+2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | [2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-[(trimethylazaniumyl)methyl]hex-4-ynyl]-trimethylazanium |
| SMILES | CC#CCC(C[N+](C)(C)C)(C[N+](C)(C)C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C30H39N3O4/c1-8-9-18-30(20-32(2,3)4,21-33(5,6)7)27(28(34)35)31-29(36)37-19-26-24-16-12-10-14-22(24)23-15-11-13-17-25(23)26/h10-17,26-27H,18-21H2,1-7H3/p+2/t27-/m0/s1 |
| InChIKey | GCZDELPJQCMISL-MHZLTWQESA-P |
| XLogP | 3.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|