C26H33N2O4+ — CID 168783080
[(2R)-2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylpent-4-enyl]-trimethylazanium (PubChem CID 168783080) has the molecular formula C26H33N2O4+ and a molecular weight of 437.56 g/mol. Its IUPAC name is [(2R)-2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylpent-4-enyl]-trimethylazanium.
| Compound Name | [(2R)-2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylpent-4-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 168783080 |
| Molecular Formula | C26H33N2O4+ |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | [(2R)-2-[(R)-carboxy-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylpent-4-enyl]-trimethylazanium |
| SMILES | C=CC[C@](C)(C[N+](C)(C)C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C26H32N2O4/c1-6-15-26(2,17-28(3,4)5)23(24(29)30)27-25(31)32-16-22-20-13-9-7-11-18(20)19-12-8-10-14-21(19)22/h6-14,22-23H,1,15-17H2,2-5H3,(H-,27,29,30,31)/p+1/t23-,26+/m0/s1 |
| InChIKey | LWGNFWZIPGMVPY-JYFHCDHNSA-O |
| XLogP | 4.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|