C24H25NO5 — CID 168783007
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(methoxymethyl)-3-methylhex-5-ynoic acid (PubChem CID 168783007) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(methoxymethyl)-3-methylhex-5-ynoic acid.
| Compound Name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(methoxymethyl)-3-methylhex-5-ynoic acid |
|---|---|
| PubChem CID | 168783007 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(methoxymethyl)-3-methylhex-5-ynoic acid |
| SMILES | C#CC[C@](C)(COC)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C24H25NO5/c1-4-13-24(2,15-29-3)21(22(26)27)25-23(28)30-14-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h1,5-12,20-21H,13-15H2,2-3H3,(H,25,28)(H,26,27)/t21-,24+/m0/s1 |
| InChIKey | TVDBQXPBAZQTKM-XUZZJYLKSA-N |
| XLogP | 3.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|