C27H31N2O4+ — CID 168782934
(2S)-2-[(3S)-3-but-2-ynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (PubChem CID 168782934) has the molecular formula C27H31N2O4+ and a molecular weight of 447.56 g/mol. Its IUPAC name is (2S)-2-[(3S)-3-but-2-ynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid.
| Compound Name | (2S)-2-[(3S)-3-but-2-ynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 168782934 |
| Molecular Formula | C27H31N2O4+ |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (2S)-2-[(3S)-3-but-2-ynyl-1,1-dimethylpyrrolidin-1-ium-3-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| SMILES | CC#CC[C@]1([C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)CC[N+](C)(C)C1 |
| InChI | InChI=1S/C27H30N2O4/c1-4-5-14-27(15-16-29(2,3)18-27)24(25(30)31)28-26(32)33-17-23-21-12-8-6-10-19(21)20-11-7-9-13-22(20)23/h6-13,23-24H,14-18H2,1-3H3,(H-,28,30,31,32)/p+1/t24-,27+/m1/s1 |
| InChIKey | YRWXQSHGKHOSLS-SQHAQQRYSA-O |
| XLogP | 3.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|