C25H17Cl2NO3 — CID 126059735
(15R,19R)-1-chloro-17-(5-chloro-2-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126059735) has the molecular formula C25H17Cl2NO3 and a molecular weight of 450.32 g/mol. Its IUPAC name is (15R,19R)-1-chloro-17-(5-chloro-2-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-1-chloro-17-(5-chloro-2-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126059735 |
| Molecular Formula | C25H17Cl2NO3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (15R,19R)-1-chloro-17-(5-chloro-2-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)[C@@H]2C3c4ccccc4C(Cl)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C25H17Cl2NO3/c1-31-19-11-10-13(26)12-18(19)28-23(29)21-20-14-6-2-4-8-16(14)25(27,22(21)24(28)30)17-9-5-3-7-15(17)20/h2-12,20-22H,1H3/t20?,21-,22-,25?/m1/s1 |
| InChIKey | BWPDGPLZJMECAL-YCIYHOANSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|