C26H20ClNO4 — CID 2909959
17-(4-chloro-2,5-dimethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 2909959) has the molecular formula C26H20ClNO4 and a molecular weight of 445.90 g/mol. Its IUPAC name is 17-(4-chloro-2,5-dimethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-(4-chloro-2,5-dimethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 2909959 |
| Molecular Formula | C26H20ClNO4 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 17-(4-chloro-2,5-dimethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COc1cc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C26H20ClNO4/c1-31-19-12-18(20(32-2)11-17(19)27)28-25(29)23-21-13-7-3-4-8-14(13)22(24(23)26(28)30)16-10-6-5-9-15(16)21/h3-12,21-24H,1-2H3 |
| InChIKey | PRPHQJIHHGIHDT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|