C26H16O3 — CID 50941432
(23R,27S)-25-oxaheptacyclo[10.10.5.02,11.04,9.013,22.015,20.023,27]heptacosa-2,4,6,8,10,13,15,17,19,21-decaene-24,26-dione (PubChem CID 50941432) has the molecular formula C26H16O3 and a molecular weight of 376.41 g/mol. Its IUPAC name is (23R,27S)-25-oxaheptacyclo[10.10.5.02,11.04,9.013,22.015,20.023,27]heptacosa-2,4,6,8,10,13,15,17,19,21-decaene-24,26-dione.
| Compound Name | (23R,27S)-25-oxaheptacyclo[10.10.5.02,11.04,9.013,22.015,20.023,27]heptacosa-2,4,6,8,10,13,15,17,19,21-decaene-24,26-dione |
|---|---|
| PubChem CID | 50941432 |
| Molecular Formula | C26H16O3 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (23R,27S)-25-oxaheptacyclo[10.10.5.02,11.04,9.013,22.015,20.023,27]heptacosa-2,4,6,8,10,13,15,17,19,21-decaene-24,26-dione |
| SMILES | O=C1OC(=O)[C@H]2C3c4cc5ccccc5cc4C(c4cc5ccccc5cc43)[C@@H]12 |
| InChI | InChI=1S/C26H16O3/c27-25-23-21-17-9-13-5-1-2-6-14(13)10-18(17)22(24(23)26(28)29-25)20-12-16-8-4-3-7-15(16)11-19(20)21/h1-12,21-24H/t21?,22?,23-,24+ |
| InChIKey | DDOIHQVNZNQNGB-ULBZPVTCSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|