C16H14N2O3 — CID 100907894
2-[(4S,4aR,11bR)-6-oxo-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl]acetonitrile (PubChem CID 100907894) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(4S,4aR,11bR)-6-oxo-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl]acetonitrile.
| Compound Name | 2-[(4S,4aR,11bR)-6-oxo-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 100907894 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[(4S,4aR,11bR)-6-oxo-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl]acetonitrile |
| SMILES | N#CC[C@@H]1CC=C[C@@H]2c3cc4c(cc3C(=O)N[C@H]12)OCO4 |
| InChI | InChI=1S/C16H14N2O3/c17-5-4-9-2-1-3-10-11-6-13-14(21-8-20-13)7-12(11)16(19)18-15(9)10/h1,3,6-7,9-10,15H,2,4,8H2,(H,18,19)/t9-,10+,15+/m0/s1 |
| InChIKey | YGYBZKKRYWMXGT-FEUHOPSXSA-N |
| XLogP | 2.10 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|