C14H13NO4 — CID 101410712
(2R,8S)-4,14,16-trioxa-9-azapentacyclo[9.7.0.02,8.03,5.013,17]octadeca-1(18),11,13(17)-trien-10-one (PubChem CID 101410712) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2R,8S)-4,14,16-trioxa-9-azapentacyclo[9.7.0.02,8.03,5.013,17]octadeca-1(18),11,13(17)-trien-10-one.
| Compound Name | (2R,8S)-4,14,16-trioxa-9-azapentacyclo[9.7.0.02,8.03,5.013,17]octadeca-1(18),11,13(17)-trien-10-one |
|---|---|
| PubChem CID | 101410712 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2R,8S)-4,14,16-trioxa-9-azapentacyclo[9.7.0.02,8.03,5.013,17]octadeca-1(18),11,13(17)-trien-10-one |
| SMILES | O=C1N[C@H]2CCC3OC3[C@@H]2c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C14H13NO4/c16-14-7-4-11-10(17-5-18-11)3-6(7)12-8(15-14)1-2-9-13(12)19-9/h3-4,8-9,12-13H,1-2,5H2,(H,15,16)/t8-,9?,12+,13?/m0/s1 |
| InChIKey | SACSXKIUEZDVBN-WKVYSXKVSA-N |
| XLogP | 1.17 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|