C14H13NO5 — CID 101486708
(3R,4S,4aR,11bS)-3,4-dihydroxy-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 101486708) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is (3R,4S,4aR,11bS)-3,4-dihydroxy-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (3R,4S,4aR,11bS)-3,4-dihydroxy-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 101486708 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (3R,4S,4aR,11bS)-3,4-dihydroxy-4,4a,5,11b-tetrahydro-3H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | O=C1N[C@H]2[C@H](O)[C@H](O)C=C[C@H]2c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C14H13NO5/c16-9-2-1-6-7-3-10-11(20-5-19-10)4-8(7)14(18)15-12(6)13(9)17/h1-4,6,9,12-13,16-17H,5H2,(H,15,18)/t6-,9+,12+,13+/m0/s1 |
| InChIKey | NQKDIWZRDUGNHJ-RFMQNAQBSA-N |
| XLogP | -0.10 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|