C16H15NO5 — CID 3847867
19-hydroxy-5,7,17-trioxa-12-azahexacyclo[10.7.1.02,10.04,8.015,20.016,18]icosa-2,4(8),9-trien-11-one (PubChem CID 3847867) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 19-hydroxy-5,7,17-trioxa-12-azahexacyclo[10.7.1.02,10.04,8.015,20.016,18]icosa-2,4(8),9-trien-11-one.
| Compound Name | 19-hydroxy-5,7,17-trioxa-12-azahexacyclo[10.7.1.02,10.04,8.015,20.016,18]icosa-2,4(8),9-trien-11-one |
|---|---|
| PubChem CID | 3847867 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 19-hydroxy-5,7,17-trioxa-12-azahexacyclo[10.7.1.02,10.04,8.015,20.016,18]icosa-2,4(8),9-trien-11-one |
| SMILES | O=C1c2cc3c(cc2C2C(O)C4OC4C4CCN1C42)OCO3 |
| InChI | InChI=1S/C16H15NO5/c18-13-11-7-3-9-10(21-5-20-9)4-8(7)16(19)17-2-1-6(12(11)17)14-15(13)22-14/h3-4,6,11-15,18H,1-2,5H2 |
| InChIKey | YYZCFSHBOPGFQJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|