C27H34CoNO3Si2 — CID 23635323
CID 23635323 (PubChem CID 23635323) has the molecular formula C27H34CoNO3Si2 and a molecular weight of 535.68 g/mol.
| Compound Name | CID 23635323 |
|---|---|
| PubChem CID | 23635323 |
| Molecular Formula | C27H34CoNO3Si2 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[C]1[CH][C]2CCN3C(=O)c4cc5c(cc4[C@@H]([C]1[Si](C)(C)C)[C@@H]23)OCO5.[CH]1[CH][CH][CH][CH]1.[Co] |
| InChI | InChI=1S/C22H29NO3Si2.C5H5.Co/c1-27(2,3)18-9-13-7-8-23-20(13)19(21(18)28(4,5)6)14-10-16-17(26-12-25-16)11-15(14)22(23)24;1-2-4-5-3-1;/h9-11,19-20H,7-8,12H2,1-6H3;1-5H;/t19-,20-;;/m1../s1 |
| InChIKey | OPIHLPHJPBGRNV-WUMQWIPTSA-N |
| XLogP | 5.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|