C17H19BrN2O8 — CID 163832669
1-[(1R,2R,3R,4S,5S,6S)-2-(6-bromo-1,3-benzodioxol-5-yl)-3,4,5,6-tetrahydroxycyclohexyl]-3-methylimidazolidine-2,4-dione (PubChem CID 163832669) has the molecular formula C17H19BrN2O8 and a molecular weight of 459.25 g/mol. Its IUPAC name is 1-[(1R,2R,3R,4S,5S,6S)-2-(6-bromo-1,3-benzodioxol-5-yl)-3,4,5,6-tetrahydroxycyclohexyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[(1R,2R,3R,4S,5S,6S)-2-(6-bromo-1,3-benzodioxol-5-yl)-3,4,5,6-tetrahydroxycyclohexyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163832669 |
| Molecular Formula | C17H19BrN2O8 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 1-[(1R,2R,3R,4S,5S,6S)-2-(6-bromo-1,3-benzodioxol-5-yl)-3,4,5,6-tetrahydroxycyclohexyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN([C@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@@H]2c2cc3c(cc2Br)OCO3)C1=O |
| InChI | InChI=1S/C17H19BrN2O8/c1-19-10(21)4-20(17(19)26)12-11(13(22)15(24)16(25)14(12)23)6-2-8-9(3-7(6)18)28-5-27-8/h2-3,11-16,22-25H,4-5H2,1H3/t11-,12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | OEZUOQQGRGZMKN-ODICJLLRSA-N |
| XLogP | -1.02 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|