C23H24BrNO6 — CID 54048583
bis(prop-2-enyl) 4-(6-bromo-1,3-benzodioxol-5-yl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 54048583) has the molecular formula C23H24BrNO6 and a molecular weight of 490.35 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-(6-bromo-1,3-benzodioxol-5-yl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-(6-bromo-1,3-benzodioxol-5-yl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54048583 |
| Molecular Formula | C23H24BrNO6 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | bis(prop-2-enyl) 4-(6-bromo-1,3-benzodioxol-5-yl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N(C)C(C)=C(C(=O)OCC=C)C1c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C23H24BrNO6/c1-6-8-28-22(26)19-13(3)25(5)14(4)20(23(27)29-9-7-2)21(19)15-10-17-18(11-16(15)24)31-12-30-17/h6-7,10-11,21H,1-2,8-9,12H2,3-5H3 |
| InChIKey | LRGVYCKKPRWTBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|