C22H22O8 — CID 98556602
dimethyl (1R,4R)-1-[(1R,4S)-2,3-bis(methoxycarbonyl)-1-bicyclo[2.2.1]hepta-2,5-dienyl]bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 98556602) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is dimethyl (1R,4R)-1-[(1R,4S)-2,3-bis(methoxycarbonyl)-1-bicyclo[2.2.1]hepta-2,5-dienyl]bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4R)-1-[(1R,4S)-2,3-bis(methoxycarbonyl)-1-bicyclo[2.2.1]hepta-2,5-dienyl]bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 98556602 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | dimethyl (1R,4R)-1-[(1R,4S)-2,3-bis(methoxycarbonyl)-1-bicyclo[2.2.1]hepta-2,5-dienyl]bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2([C@]34C=C[C@@H](C3)C(C(=O)OC)=C4C(=O)OC)C=C[C@@H]1C2 |
| InChI | InChI=1S/C22H22O8/c1-27-17(23)13-11-5-7-21(9-11,15(13)19(25)29-3)22-8-6-12(10-22)14(18(24)28-2)16(22)20(26)30-4/h5-8,11-12H,9-10H2,1-4H3/t11-,12+,21-,22-/m1/s1 |
| InChIKey | AJJQXGUBIJIMLJ-AENYNOTOSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|