C24H22N2O4 — CID 10341045
dimethyl (1R,2R,5R,9S)-12-(dicyanomethylidene)-8,8-dimethyltetracyclo[7.3.2.12,5.02,7]pentadeca-3,6,10,13-tetraene-3,4-dicarboxylate (PubChem CID 10341045) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is dimethyl (1R,2R,5R,9S)-12-(dicyanomethylidene)-8,8-dimethyltetracyclo[7.3.2.12,5.02,7]pentadeca-3,6,10,13-tetraene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,2R,5R,9S)-12-(dicyanomethylidene)-8,8-dimethyltetracyclo[7.3.2.12,5.02,7]pentadeca-3,6,10,13-tetraene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10341045 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | dimethyl (1R,2R,5R,9S)-12-(dicyanomethylidene)-8,8-dimethyltetracyclo[7.3.2.12,5.02,7]pentadeca-3,6,10,13-tetraene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]23C[C@@H]1C=C2C(C)(C)[C@@H]1C=CC(=C(C#N)C#N)[C@H]3C=C1 |
| InChI | InChI=1S/C24H22N2O4/c1-23(2)15-5-7-16(14(11-25)12-26)17(8-6-15)24-10-13(9-18(23)24)19(21(27)29-3)20(24)22(28)30-4/h5-9,13,15,17H,10H2,1-4H3/t13-,15+,17+,24+/m0/s1 |
| InChIKey | VIOBPLPMSMQYDV-URMSHRHKSA-N |
| XLogP | 3.32 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|