C11H12N2 — CID 593829
2-(4,5,5-trimethylcyclopent-2-en-1-ylidene)propanedinitrile (PubChem CID 593829) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(4,5,5-trimethylcyclopent-2-en-1-ylidene)propanedinitrile.
| Compound Name | 2-(4,5,5-trimethylcyclopent-2-en-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 593829 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-(4,5,5-trimethylcyclopent-2-en-1-ylidene)propanedinitrile |
| SMILES | CC1C=CC(=C(C#N)C#N)C1(C)C |
| InChI | InChI=1S/C11H12N2/c1-8-4-5-10(11(8,2)3)9(6-12)7-13/h4-5,8H,1-3H3 |
| InChIKey | OPHBWSMRGWTGHY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|