C11H10N2S — CID 176682096
2-(4-ethenyl-5,5-dimethylthiophen-2-ylidene)propanedinitrile (PubChem CID 176682096) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(4-ethenyl-5,5-dimethylthiophen-2-ylidene)propanedinitrile.
| Compound Name | 2-(4-ethenyl-5,5-dimethylthiophen-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 176682096 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-(4-ethenyl-5,5-dimethylthiophen-2-ylidene)propanedinitrile |
| SMILES | C=CC1=CC(=C(C#N)C#N)SC1(C)C |
| InChI | InChI=1S/C11H10N2S/c1-4-9-5-10(8(6-12)7-13)14-11(9,2)3/h4-5H,1H2,2-3H3 |
| InChIKey | CVVODFZEGRUWDC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|