methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate

C8H9N3O2 — CID 13098642

IUPACmethyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate
SMILESCOC(=O)C1=C(C#N)N=NC1(C)C
InChIInChI=1S/C8H9N3O2/c1-8(2)6(7(12)13-3)5(4-9)10-11-8/h1-3H3
InChIKeyQMSXNPHVQSIFIX-UHFFFAOYSA-N
MW179.18 g/mol
LogP1.18
Rot. Bonds1

About methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate

methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate (PubChem CID 13098642) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate
PubChem CID13098642
Molecular FormulaC8H9N3O2
Molecular Weight179.18 g/mol
Exact Mass179.07
IUPAC Namemethyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate
SMILESCOC(=O)C1=C(C#N)N=NC1(C)C
InChIInChI=1S/C8H9N3O2/c1-8(2)6(7(12)13-3)5(4-9)10-11-8/h1-3H3
InChIKeyQMSXNPHVQSIFIX-UHFFFAOYSA-N
XLogP1.18
TPSA74.81 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.18
LogP ≤ 51.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The IUPAC name of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate (CID 13098642) is methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The canonical SMILES for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate is COC(=O)C1=C(C#N)N=NC1(C)C.
What is the InChIKey of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The InChIKey is QMSXNPHVQSIFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-8(2)6(7(12)13-3)5(4-9)10-11-8/h1-3H3.
What are the key properties of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate has a molecular weight of 179.18 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 13098642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).