About methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate
methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate (PubChem CID 13098642) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate.
Analyze methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The IUPAC name of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate (CID 13098642) is methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The canonical SMILES for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate is COC(=O)C1=C(C#N)N=NC1(C)C.
What is the InChIKey of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
The InChIKey is QMSXNPHVQSIFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-8(2)6(7(12)13-3)5(4-9)10-11-8/h1-3H3.
What are the key properties of methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate?
methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate has a molecular weight of 179.18 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyano-3,3-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 13098642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).