C6H6O4S — CID 71322546
dimethyl thiirene-2,3-dicarboxylate (PubChem CID 71322546) has the molecular formula C6H6O4S and a molecular weight of 174.18 g/mol. Its IUPAC name is dimethyl thiirene-2,3-dicarboxylate.
| Compound Name | dimethyl thiirene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71322546 |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | dimethyl thiirene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)S1 |
| InChI | InChI=1S/C6H6O4S/c1-9-5(7)3-4(11-3)6(8)10-2/h1-2H3 |
| InChIKey | PVXIJHKRIIKKNV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |