C16H14N2O4S6 — CID 159507392
dimethyl 2-[4,5-bis(2-isocyanoethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 159507392) has the molecular formula C16H14N2O4S6 and a molecular weight of 490.70 g/mol. Its IUPAC name is dimethyl 2-[4,5-bis(2-isocyanoethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[4,5-bis(2-isocyanoethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 159507392 |
| Molecular Formula | C16H14N2O4S6 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 489.93 |
| IUPAC Name | dimethyl 2-[4,5-bis(2-isocyanoethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | [C-]#[N+]CCSC1=C(SCC[N+]#[C-])SC(=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C16H14N2O4S6/c1-17-5-7-23-13-14(24-8-6-18-2)28-16(27-13)15-25-9(11(19)21-3)10(26-15)12(20)22-4/h5-8H2,3-4H3 |
| InChIKey | GUNUIXNFTKARFB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|