C12H10O4S4Se2 — CID 11733861
dimethyl 2-(5,6-dihydro-[1,4]diselenino[2,3-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11733861) has the molecular formula C12H10O4S4Se2 and a molecular weight of 504.40 g/mol. Its IUPAC name is dimethyl 2-(5,6-dihydro-[1,4]diselenino[2,3-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,6-dihydro-[1,4]diselenino[2,3-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11733861 |
| Molecular Formula | C12H10O4S4Se2 |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 505.78 |
| IUPAC Name | dimethyl 2-(5,6-dihydro-[1,4]diselenino[2,3-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(S2)[Se]CC[Se]3)S1 |
| InChI | InChI=1S/C12H10O4S4Se2/c1-15-7(13)5-6(8(14)16-2)18-9(17-5)10-19-11-12(20-10)22-4-3-21-11/h3-4H2,1-2H3 |
| InChIKey | ZUGMWJNYWQLBMJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|