C25H20O2S4 — CID 15417467
methyl 2-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-methyl-1,3-dithiole-4-carboxylate (PubChem CID 15417467) has the molecular formula C25H20O2S4 and a molecular weight of 480.70 g/mol. Its IUPAC name is methyl 2-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-methyl-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-methyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 15417467 |
| Molecular Formula | C25H20O2S4 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | methyl 2-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-methyl-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=C(C)SC(=c2c3ccccc3c(=C3SC(C)=C(C)S3)c3ccccc23)S1 |
| InChI | InChI=1S/C25H20O2S4/c1-13-14(2)29-24(28-13)20-16-9-5-7-11-18(16)21(19-12-8-6-10-17(19)20)25-30-15(3)22(31-25)23(26)27-4/h5-12H,1-4H3 |
| InChIKey | MGZBLMBWIYSQBE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|