C24H26O4S10 — CID 10101224
methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[4-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-1,3-dithiole-4-carboxylate (PubChem CID 10101224) has the molecular formula C24H26O4S10 and a molecular weight of 699.14 g/mol. Its IUPAC name is methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[4-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[4-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 10101224 |
| Molecular Formula | C24H26O4S10 |
| Molecular Weight | 699.14 g/mol |
| Exact Mass | 697.90 |
| IUPAC Name | methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[4-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=C(SCCCCSC2=C(C(=O)OC)SC(=C3SC(C)=C(C)S3)S2)SC(=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C24H26O4S10/c1-11-12(2)32-21(31-11)23-35-15(17(25)27-5)19(37-23)29-9-7-8-10-30-20-16(18(26)28-6)36-24(38-20)22-33-13(3)14(4)34-22/h7-10H2,1-6H3 |
| InChIKey | PVOJAYFBYQXNBO-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.14 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|