C16H12NiO8S8-4 — CID 134868916
bis(5,6-bis(methoxycarbonyl)-1,4-dithiine-2,3-dithiolate);nickel (PubChem CID 134868916) has the molecular formula C16H12NiO8S8-4 and a molecular weight of 647.49 g/mol. Its IUPAC name is bis(5,6-bis(methoxycarbonyl)-1,4-dithiine-2,3-dithiolate);nickel.
| Compound Name | bis(5,6-bis(methoxycarbonyl)-1,4-dithiine-2,3-dithiolate);nickel |
|---|---|
| PubChem CID | 134868916 |
| Molecular Formula | C16H12NiO8S8-4 |
| Molecular Weight | 647.49 g/mol |
| Exact Mass | 645.77 |
| IUPAC Name | bis(5,6-bis(methoxycarbonyl)-1,4-dithiine-2,3-dithiolate);nickel |
| SMILES | COC(=O)C1=C(C(=O)OC)SC([S-])=C([S-])S1.COC(=O)C1=C(C(=O)OC)SC([S-])=C([S-])S1.[Ni] |
| InChI | InChI=1S/2C8H8O4S4.Ni/c2*1-11-5(9)3-4(6(10)12-2)16-8(14)7(13)15-3;/h2*13-14H,1-2H3;/p-4 |
| InChIKey | AAPPSRRVIOYHMY-UHFFFAOYSA-J |
| XLogP | 2.49 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|