C20H14O8S4 — CID 11191448
dimethyl 2-[6-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]hexa-2,4-diynylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11191448) has the molecular formula C20H14O8S4 and a molecular weight of 510.59 g/mol. Its IUPAC name is dimethyl 2-[6-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]hexa-2,4-diynylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[6-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]hexa-2,4-diynylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11191448 |
| Molecular Formula | C20H14O8S4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | dimethyl 2-[6-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]hexa-2,4-diynylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC#CC#CC=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C20H14O8S4/c1-25-17(21)13-14(18(22)26-2)30-11(29-13)9-7-5-6-8-10-12-31-15(19(23)27-3)16(32-12)20(24)28-4/h9-10H,1-4H3 |
| InChIKey | IHNGNIWLXWTQIV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|