C21H16O9S4Se2 — CID 11146883
dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-(1,3-diselenol-2-ylidene)-4-oxobutylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11146883) has the molecular formula C21H16O9S4Se2 and a molecular weight of 698.54 g/mol. Its IUPAC name is dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-(1,3-diselenol-2-ylidene)-4-oxobutylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-(1,3-diselenol-2-ylidene)-4-oxobutylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11146883 |
| Molecular Formula | C21H16O9S4Se2 |
| Molecular Weight | 698.54 g/mol |
| Exact Mass | 699.80 |
| IUPAC Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-(1,3-diselenol-2-ylidene)-4-oxobutylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(=C2[Se]C=C[Se]2)C(C=O)=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C21H16O9S4Se2/c1-27-16(23)12-13(17(24)28-2)32-11(31-12)7-9(21-35-5-6-36-21)10(8-22)20-33-14(18(25)29-3)15(34-20)19(26)30-4/h5-8H,1-4H3 |
| InChIKey | OCKBWKABRHWOQD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|