C24H20O8S8 — CID 101355998
dimethyl 2-[4-[5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]cyclohexylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101355998) has the molecular formula C24H20O8S8 and a molecular weight of 692.95 g/mol. Its IUPAC name is dimethyl 2-[4-[5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]cyclohexylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[4-[5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]cyclohexylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101355998 |
| Molecular Formula | C24H20O8S8 |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 691.89 |
| IUPAC Name | dimethyl 2-[4-[5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]cyclohexylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2CCC(=C3SC4=C(S3)SC(=C3SC(C(=O)OC)=C(C(=O)OC)S3)S4)CC2)S1 |
| InChI | InChI=1S/C24H20O8S8/c1-29-15(25)11-12(16(26)30-2)34-19(33-11)9-5-7-10(8-6-9)20-37-23-24(38-20)40-22(39-23)21-35-13(17(27)31-3)14(36-21)18(28)32-4/h5-8H2,1-4H3 |
| InChIKey | PXHPFPKTBGFMPC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|