C20H16O4S10 — CID 101230705
dimethyl 2-[2-[5-[2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]ethylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101230705) has the molecular formula C20H16O4S10 and a molecular weight of 641.01 g/mol. Its IUPAC name is dimethyl 2-[2-[5-[2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]ethylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-[5-[2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]ethylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101230705 |
| Molecular Formula | C20H16O4S10 |
| Molecular Weight | 641.01 g/mol |
| Exact Mass | 639.83 |
| IUPAC Name | dimethyl 2-[2-[5-[2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]ethylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC=C2SC3=C(SC(=CC=C4SC(SC)=C(SC)S4)S3)S2)S1 |
| InChI | InChI=1S/C20H16O4S10/c1-23-15(21)13-14(16(22)24-2)28-9(27-13)5-6-11-31-19-20(32-11)34-12(33-19)8-7-10-29-17(25-3)18(26-4)30-10/h5-8H,1-4H3/b11-6-,12-8+ |
| InChIKey | VWXLENDMIQNYJZ-MOUHLLIUSA-N |
| XLogP | 8.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.01 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'} |
|---|