C34H38O8S4Si2 — CID 139123759
dimethyl 2-[1-[4-[1-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethyl]-2,5-bis(2-trimethylsilylethynyl)phenyl]ethylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 139123759) has the molecular formula C34H38O8S4Si2 and a molecular weight of 759.11 g/mol. Its IUPAC name is dimethyl 2-[1-[4-[1-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethyl]-2,5-bis(2-trimethylsilylethynyl)phenyl]ethylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[1-[4-[1-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethyl]-2,5-bis(2-trimethylsilylethynyl)phenyl]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 139123759 |
| Molecular Formula | C34H38O8S4Si2 |
| Molecular Weight | 759.11 g/mol |
| Exact Mass | 758.10 |
| IUPAC Name | dimethyl 2-[1-[4-[1-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethyl]-2,5-bis(2-trimethylsilylethynyl)phenyl]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C(C)c2cc(C#C[Si](C)(C)C)c(C(C)=C3SC(C(=O)OC)=C(C(=O)OC)S3)cc2C#C[Si](C)(C)C)S1 |
| InChI | InChI=1S/C34H38O8S4Si2/c1-19(33-43-25(29(35)39-3)26(44-33)30(36)40-4)23-17-22(14-16-48(10,11)12)24(18-21(23)13-15-47(7,8)9)20(2)34-45-27(31(37)41-5)28(46-34)32(38)42-6/h17-18H,1-12H3 |
| InChIKey | SZFDEGDFDVKHTK-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.11 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|