C25H24F6N2O4Si — CID 159666881
methyl 2-amino-5-ethynyl-4-(trifluoromethyl)benzoate;methyl 2-amino-4-(trifluoromethyl)-5-(2-trimethylsilylethynyl)benzoate (PubChem CID 159666881) has the molecular formula C25H24F6N2O4Si and a molecular weight of 558.55 g/mol. Its IUPAC name is methyl 2-amino-5-ethynyl-4-(trifluoromethyl)benzoate;methyl 2-amino-4-(trifluoromethyl)-5-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2-amino-5-ethynyl-4-(trifluoromethyl)benzoate;methyl 2-amino-4-(trifluoromethyl)-5-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 159666881 |
| Molecular Formula | C25H24F6N2O4Si |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | methyl 2-amino-5-ethynyl-4-(trifluoromethyl)benzoate;methyl 2-amino-4-(trifluoromethyl)-5-(2-trimethylsilylethynyl)benzoate |
| SMILES | C#Cc1cc(C(=O)OC)c(N)cc1C(F)(F)F.COC(=O)c1cc(C#C[Si](C)(C)C)c(C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H16F3NO2Si.C11H8F3NO2/c1-20-13(19)10-7-9(5-6-21(2,3)4)11(8-12(10)18)14(15,16)17;1-3-6-4-7(10(16)17-2)9(15)5-8(6)11(12,13)14/h7-8H,18H2,1-4H3;1,4-5H,15H2,2H3 |
| InChIKey | MTNDJYPYJZGEEK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|