C15H13F3N2O2 — CID 67976976
methyl 2-amino-5-(4-aminophenyl)-4-(trifluoromethyl)benzoate (PubChem CID 67976976) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is methyl 2-amino-5-(4-aminophenyl)-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-amino-5-(4-aminophenyl)-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 67976976 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | methyl 2-amino-5-(4-aminophenyl)-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(N)cc2)c(C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H13F3N2O2/c1-22-14(21)11-6-10(8-2-4-9(19)5-3-8)12(7-13(11)20)15(16,17)18/h2-7H,19-20H2,1H3 |
| InChIKey | ANGIKNVJJIMNID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|