C23H22F6IN4O4+ — CID 160708005
methyl 2-amino-5-(1,3-dimethyl-3H-pyrazol-1-ium-5-yl)-4-(trifluoromethyl)benzoate;methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (PubChem CID 160708005) has the molecular formula C23H22F6IN4O4+ and a molecular weight of 659.35 g/mol. Its IUPAC name is methyl 2-amino-5-(1,3-dimethyl-3H-pyrazol-1-ium-5-yl)-4-(trifluoromethyl)benzoate;methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-amino-5-(1,3-dimethyl-3H-pyrazol-1-ium-5-yl)-4-(trifluoromethyl)benzoate;methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 160708005 |
| Molecular Formula | C23H22F6IN4O4+ |
| Molecular Weight | 659.35 g/mol |
| Exact Mass | 659.06 |
| IUPAC Name | methyl 2-amino-5-(1,3-dimethyl-3H-pyrazol-1-ium-5-yl)-4-(trifluoromethyl)benzoate;methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C2=CC(C)N=[N+]2C)c(C(F)(F)F)cc1N.COC(=O)c1cc(I)c(C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H14F3N3O2.C9H7F3INO2/c1-7-4-12(20(2)19-7)8-5-9(13(21)22-3)11(18)6-10(8)14(15,16)17;1-16-8(15)4-2-6(13)5(3-7(4)14)9(10,11)12/h4-7H,1-3H3,(H-,18,21);2-3H,14H2,1H3/p+1 |
| InChIKey | RCWYKRPVFVSZIA-UHFFFAOYSA-O |
| XLogP | 5.59 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|