C18H23F3N3O3S+ — CID 153050133
2-[5-[4-amino-5-methoxycarbonyl-2-(trifluoromethyl)phenyl]-3-methylpyrazol-1-yl]ethoxymethyl-dimethylsulfanium (PubChem CID 153050133) has the molecular formula C18H23F3N3O3S+ and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-[5-[4-amino-5-methoxycarbonyl-2-(trifluoromethyl)phenyl]-3-methylpyrazol-1-yl]ethoxymethyl-dimethylsulfanium.
| Compound Name | 2-[5-[4-amino-5-methoxycarbonyl-2-(trifluoromethyl)phenyl]-3-methylpyrazol-1-yl]ethoxymethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 153050133 |
| Molecular Formula | C18H23F3N3O3S+ |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[5-[4-amino-5-methoxycarbonyl-2-(trifluoromethyl)phenyl]-3-methylpyrazol-1-yl]ethoxymethyl-dimethylsulfanium |
| SMILES | COC(=O)c1cc(-c2cc(C)nn2CCOC[S+](C)C)c(C(F)(F)F)cc1N |
| InChI | InChI=1S/C18H22F3N3O3S/c1-11-7-16(24(23-11)5-6-27-10-28(3)4)12-8-13(17(25)26-2)15(22)9-14(12)18(19,20)21/h7-9H,5-6,10H2,1-4H3,(H-,22,23,25)/p+1 |
| InChIKey | VHJXFAOJACFDQJ-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|