C28H17F6NO2 — CID 162717110
methyl 3-amino-7-[2,4-bis(trifluoromethyl)phenyl]triphenylene-2-carboxylate (PubChem CID 162717110) has the molecular formula C28H17F6NO2 and a molecular weight of 513.44 g/mol. Its IUPAC name is methyl 3-amino-7-[2,4-bis(trifluoromethyl)phenyl]triphenylene-2-carboxylate.
| Compound Name | methyl 3-amino-7-[2,4-bis(trifluoromethyl)phenyl]triphenylene-2-carboxylate |
|---|---|
| PubChem CID | 162717110 |
| Molecular Formula | C28H17F6NO2 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | methyl 3-amino-7-[2,4-bis(trifluoromethyl)phenyl]triphenylene-2-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc3c2cc1N |
| InChI | InChI=1S/C28H17F6NO2/c1-37-26(36)23-12-21-18-5-3-2-4-17(18)20-10-14(6-8-19(20)22(21)13-25(23)35)16-9-7-15(27(29,30)31)11-24(16)28(32,33)34/h2-13H,35H2,1H3 |
| InChIKey | XPMDCMXAOQRNRN-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|