C22H34O2S5 — CID 14901621
ethyl 11-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]sulfanyl]undecanoate (PubChem CID 14901621) has the molecular formula C22H34O2S5 and a molecular weight of 490.85 g/mol. Its IUPAC name is ethyl 11-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]sulfanyl]undecanoate.
| Compound Name | ethyl 11-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]sulfanyl]undecanoate |
|---|---|
| PubChem CID | 14901621 |
| Molecular Formula | C22H34O2S5 |
| Molecular Weight | 490.85 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | ethyl 11-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]sulfanyl]undecanoate |
| SMILES | CCOC(=O)CCCCCCCCCCSC1=C(C)SC(=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C22H34O2S5/c1-5-24-19(23)14-12-10-8-6-7-9-11-13-15-25-20-18(4)28-22(29-20)21-26-16(2)17(3)27-21/h5-15H2,1-4H3 |
| InChIKey | WYJASRUIPJEOGA-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.85 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|