C16H16O8S3 — CID 15942016
tetramethyl 9-methyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate (PubChem CID 15942016) has the molecular formula C16H16O8S3 and a molecular weight of 432.50 g/mol. Its IUPAC name is tetramethyl 9-methyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate.
| Compound Name | tetramethyl 9-methyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 15942016 |
| Molecular Formula | C16H16O8S3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | tetramethyl 9-methyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(C=C(C)SC(C(=O)OC)=C2C(=O)OC)S1 |
| InChI | InChI=1S/C16H16O8S3/c1-7-6-16(8(12(17)21-2)9(25-7)13(18)22-3)26-10(14(19)23-4)11(27-16)15(20)24-5/h6H,1-5H3 |
| InChIKey | POKGFMFMURSPET-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|