C22H20O9S3 — CID 11840428
tetramethyl 9-(4-methoxyphenyl)-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate (PubChem CID 11840428) has the molecular formula C22H20O9S3 and a molecular weight of 524.59 g/mol. Its IUPAC name is tetramethyl 9-(4-methoxyphenyl)-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate.
| Compound Name | tetramethyl 9-(4-methoxyphenyl)-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 11840428 |
| Molecular Formula | C22H20O9S3 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | tetramethyl 9-(4-methoxyphenyl)-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(C=C(c3ccc(OC)cc3)SC(C(=O)OC)=C2C(=O)OC)S1 |
| InChI | InChI=1S/C22H20O9S3/c1-27-12-8-6-11(7-9-12)13-10-22(14(18(23)28-2)15(32-13)19(24)29-3)33-16(20(25)30-4)17(34-22)21(26)31-5/h6-10H,1-5H3 |
| InChIKey | OROROXADGDHSAS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|