C35H33NO10S3 — CID 5009541
tetramethyl 6'-[3-(4-methoxyphenyl)prop-2-enoyl]-5',5',7'-trimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 5009541) has the molecular formula C35H33NO10S3 and a molecular weight of 723.85 g/mol. Its IUPAC name is tetramethyl 6'-[3-(4-methoxyphenyl)prop-2-enoyl]-5',5',7'-trimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 6'-[3-(4-methoxyphenyl)prop-2-enoyl]-5',5',7'-trimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 5009541 |
| Molecular Formula | C35H33NO10S3 |
| Molecular Weight | 723.85 g/mol |
| Exact Mass | 723.13 |
| IUPAC Name | tetramethyl 6'-[3-(4-methoxyphenyl)prop-2-enoyl]-5',5',7'-trimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2cccc(C)c2N(C(=O)C=Cc2ccc(OC)cc2)C1(C)C |
| InChI | InChI=1S/C35H33NO10S3/c1-18-10-9-11-21-23-29(34(2,3)36(25(18)21)22(37)17-14-19-12-15-20(42-4)16-13-19)47-26(31(39)44-6)24(30(38)43-5)35(23)48-27(32(40)45-7)28(49-35)33(41)46-8/h9-17H,1-8H3 |
| InChIKey | LLCQXUUXYVOLMK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.85 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|