C37H39NO9S3 — CID 3899395
tetraethyl 5',5',8'-trimethyl-6'-(2-phenylacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3899395) has the molecular formula C37H39NO9S3 and a molecular weight of 737.92 g/mol. Its IUPAC name is tetraethyl 5',5',8'-trimethyl-6'-(2-phenylacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetraethyl 5',5',8'-trimethyl-6'-(2-phenylacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3899395 |
| Molecular Formula | C37H39NO9S3 |
| Molecular Weight | 737.92 g/mol |
| Exact Mass | 737.18 |
| IUPAC Name | tetraethyl 5',5',8'-trimethyl-6'-(2-phenylacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)SC2(S1)C(C(=O)OCC)=C(C(=O)OCC)SC1=C2c2ccc(C)cc2N(C(=O)Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C37H39NO9S3/c1-8-44-32(40)27-28(33(41)45-9-2)48-31-26(37(27)49-29(34(42)46-10-3)30(50-37)35(43)47-11-4)23-18-17-21(5)19-24(23)38(36(31,6)7)25(39)20-22-15-13-12-14-16-22/h12-19H,8-11,20H2,1-7H3 |
| InChIKey | STGIUNIYOPLKSU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.92 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|