C39H40N2O10S5 — CID 3117908
tetraethyl 6'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-8'-ethoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3117908) has the molecular formula C39H40N2O10S5 and a molecular weight of 857.09 g/mol. Its IUPAC name is tetraethyl 6'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-8'-ethoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetraethyl 6'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-8'-ethoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3117908 |
| Molecular Formula | C39H40N2O10S5 |
| Molecular Weight | 857.09 g/mol |
| Exact Mass | 856.13 |
| IUPAC Name | tetraethyl 6'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-8'-ethoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)SC2(S1)C(C(=O)OCC)=C(C(=O)OCC)SC1=C2c2ccc(OCC)cc2N(C(=O)CSc2nc3ccccc3s2)C1(C)C |
| InChI | InChI=1S/C39H40N2O10S5/c1-8-47-21-17-18-22-24(19-21)41(26(42)20-52-37-40-23-15-13-14-16-25(23)53-37)38(6,7)32-27(22)39(28(33(43)48-9-2)29(54-32)34(44)49-10-3)55-30(35(45)50-11-4)31(56-39)36(46)51-12-5/h13-19H,8-12,20H2,1-7H3 |
| InChIKey | YMLPZVXTRGTJJZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 147.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.09 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|